C23H16Cl2N2O2S — CID 137069537
(5Z)-5-[(3,5-dichloro-2-phenylmethoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 137069537) has the molecular formula C23H16Cl2N2O2S and a molecular weight of 455.37 g/mol. Its IUPAC name is (5Z)-5-[(3,5-dichloro-2-phenylmethoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3,5-dichloro-2-phenylmethoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137069537 |
| Molecular Formula | C23H16Cl2N2O2S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | (5Z)-5-[(3,5-dichloro-2-phenylmethoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccccc2)S/C1=C\c1cc(Cl)cc(Cl)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H16Cl2N2O2S/c24-17-11-16(21(19(25)13-17)29-14-15-7-3-1-4-8-15)12-20-22(28)27-23(30-20)26-18-9-5-2-6-10-18/h1-13H,14H2,(H,26,27,28)/b20-12- |
| InChIKey | GHBRDBHYKQZXQI-NDENLUEZSA-N |
| XLogP | 6.46 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|