C17H10ClN3O5S — CID 137072068
(5E)-2-(2-chlorophenyl)imino-5-[(4-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137072068) has the molecular formula C17H10ClN3O5S and a molecular weight of 403.80 g/mol. Its IUPAC name is (5E)-2-(2-chlorophenyl)imino-5-[(4-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2-chlorophenyl)imino-5-[(4-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137072068 |
| Molecular Formula | C17H10ClN3O5S |
| Molecular Weight | 403.80 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | (5E)-2-(2-chlorophenyl)imino-5-[(4-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccccc2Cl)S/C1=C/c1ccc2c(c1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C17H10ClN3O5S/c18-10-3-1-2-4-11(10)19-17-20-16(22)13(27-17)7-9-5-6-12-15(26-8-25-12)14(9)21(23)24/h1-7H,8H2,(H,19,20,22)/b13-7+ |
| InChIKey | DXHCQJURIZOLPS-NTUHNPAUSA-N |
| XLogP | 3.87 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.80 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|