C19H13ClN2O2S — CID 137074800
(5Z)-5-[(3-chloro-4-prop-2-ynoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 137074800) has the molecular formula C19H13ClN2O2S and a molecular weight of 368.85 g/mol. Its IUPAC name is (5Z)-5-[(3-chloro-4-prop-2-ynoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-chloro-4-prop-2-ynoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137074800 |
| Molecular Formula | C19H13ClN2O2S |
| Molecular Weight | 368.85 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | (5Z)-5-[(3-chloro-4-prop-2-ynoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | C#CCOc1ccc(/C=C2\S/C(=N/c3ccccc3)NC2=O)cc1Cl |
| InChI | InChI=1S/C19H13ClN2O2S/c1-2-10-24-16-9-8-13(11-15(16)20)12-17-18(23)22-19(25-17)21-14-6-4-3-5-7-14/h1,3-9,11-12H,10H2,(H,21,22,23)/b17-12- |
| InChIKey | RHUWEYGINQFWOD-ATVHPVEESA-N |
| XLogP | 4.24 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.85 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|