C20H16N6O6 — CID 137075536
methyl (7R)-6-(4-methoxybenzoyl)-7-(2-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate (PubChem CID 137075536) has the molecular formula C20H16N6O6 and a molecular weight of 436.38 g/mol. Its IUPAC name is methyl (7R)-6-(4-methoxybenzoyl)-7-(2-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate.
| Compound Name | methyl (7R)-6-(4-methoxybenzoyl)-7-(2-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137075536 |
| Molecular Formula | C20H16N6O6 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | methyl (7R)-6-(4-methoxybenzoyl)-7-(2-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C(=O)c2ccc(OC)cc2)[C@@H](c2ccccc2[N+](=O)[O-])n2nnnc2N1 |
| InChI | InChI=1S/C20H16N6O6/c1-31-12-9-7-11(8-10-12)18(27)15-16(19(28)32-2)21-20-22-23-24-25(20)17(15)13-5-3-4-6-14(13)26(29)30/h3-10,17H,1-2H3,(H,21,22,24)/t17-/m1/s1 |
| InChIKey | FRXCKPMQWNWTHG-QGZVFWFLSA-N |
| XLogP | 1.91 |
| TPSA | 151.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|