C19H14N6O5 — CID 137121757
methyl (7R)-6-benzoyl-7-(2-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate (PubChem CID 137121757) has the molecular formula C19H14N6O5 and a molecular weight of 406.36 g/mol. Its IUPAC name is methyl (7R)-6-benzoyl-7-(2-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate.
| Compound Name | methyl (7R)-6-benzoyl-7-(2-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137121757 |
| Molecular Formula | C19H14N6O5 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | methyl (7R)-6-benzoyl-7-(2-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C(=O)c2ccccc2)[C@@H](c2ccccc2[N+](=O)[O-])n2nnnc2N1 |
| InChI | InChI=1S/C19H14N6O5/c1-30-18(27)15-14(17(26)11-7-3-2-4-8-11)16(24-19(20-15)21-22-23-24)12-9-5-6-10-13(12)25(28)29/h2-10,16H,1H3,(H,20,21,23)/t16-/m1/s1 |
| InChIKey | FMJUZBPGXAVNJO-MRXNPFEDSA-N |
| XLogP | 1.91 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|