C12H11N7O3 — CID 696393
(7S)-5-methyl-7-(2-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 696393) has the molecular formula C12H11N7O3 and a molecular weight of 301.27 g/mol. Its IUPAC name is (7S)-5-methyl-7-(2-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-5-methyl-7-(2-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 696393 |
| Molecular Formula | C12H11N7O3 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (7S)-5-methyl-7-(2-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(N)=O)[C@H](c2ccccc2[N+](=O)[O-])n2nnnc2N1 |
| InChI | InChI=1S/C12H11N7O3/c1-6-9(11(13)20)10(18-12(14-6)15-16-17-18)7-4-2-3-5-8(7)19(21)22/h2-5,10H,1H3,(H2,13,20)(H,14,15,17)/t10-/m0/s1 |
| InChIKey | KRGUSLKZPZOEEC-JTQLQIEISA-N |
| XLogP | 0.36 |
| TPSA | 141.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|