C23H16N4OS — CID 137081367
5-(benzimidazol-5-ylidenemethyl)-3-phenyl-2-phenylimino-1,3-thiazol-4-ol (PubChem CID 137081367) has the molecular formula C23H16N4OS and a molecular weight of 396.48 g/mol. Its IUPAC name is 5-(benzimidazol-5-ylidenemethyl)-3-phenyl-2-phenylimino-1,3-thiazol-4-ol.
| Compound Name | 5-(benzimidazol-5-ylidenemethyl)-3-phenyl-2-phenylimino-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 137081367 |
| Molecular Formula | C23H16N4OS |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 5-(benzimidazol-5-ylidenemethyl)-3-phenyl-2-phenylimino-1,3-thiazol-4-ol |
| SMILES | Oc1c(C=c2ccc3c(c2)N=CN=3)s/c(=N\c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C23H16N4OS/c28-22-21(14-16-11-12-19-20(13-16)25-15-24-19)29-23(26-17-7-3-1-4-8-17)27(22)18-9-5-2-6-10-18/h1-15,28H/b16-14?,26-23- |
| InChIKey | ZSZYGPSAJIUMOM-XZTXUZLJSA-N |
| XLogP | 3.60 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |