C45H56N2O2 — CID 137081709
4-(9,9-dioctylfluoren-2-yl)-2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol (PubChem CID 137081709) has the molecular formula C45H56N2O2 and a molecular weight of 656.96 g/mol. Its IUPAC name is 4-(9,9-dioctylfluoren-2-yl)-2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol.
| Compound Name | 4-(9,9-dioctylfluoren-2-yl)-2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 137081709 |
| Molecular Formula | C45H56N2O2 |
| Molecular Weight | 656.96 g/mol |
| Exact Mass | 656.43 |
| IUPAC Name | 4-(9,9-dioctylfluoren-2-yl)-2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2ccccc2-c2ccc(-c3ccc(O)c(/C=N/CC/N=C/c4ccccc4O)c3)cc21 |
| InChI | InChI=1S/C45H56N2O2/c1-3-5-7-9-11-17-27-45(28-18-12-10-8-6-4-2)41-21-15-14-20-39(41)40-25-23-36(32-42(40)45)35-24-26-44(49)38(31-35)34-47-30-29-46-33-37-19-13-16-22-43(37)48/h13-16,19-26,31-34,48-49H,3-12,17-18,27-30H2,1-2H3/b46-33+,47-34+ |
| InChIKey | UJKRMMOKAVZDFQ-LFDKMKOQSA-N |
| XLogP | 12.07 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.96 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|