C13H18N4O4S2 — CID 137081977
5-amino-3-[(2S,5R)-2-(1-hydroxypentyl)-1,3-oxathiolan-5-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione (PubChem CID 137081977) has the molecular formula C13H18N4O4S2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 5-amino-3-[(2S,5R)-2-(1-hydroxypentyl)-1,3-oxathiolan-5-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione.
| Compound Name | 5-amino-3-[(2S,5R)-2-(1-hydroxypentyl)-1,3-oxathiolan-5-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 137081977 |
| Molecular Formula | C13H18N4O4S2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 5-amino-3-[(2S,5R)-2-(1-hydroxypentyl)-1,3-oxathiolan-5-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
| SMILES | CCCCC(O)[C@H]1O[C@@H](n2c(=O)sc3c(=O)[nH]c(N)nc32)CS1 |
| InChI | InChI=1S/C13H18N4O4S2/c1-2-3-4-6(18)11-21-7(5-22-11)17-9-8(23-13(17)20)10(19)16-12(14)15-9/h6-7,11,18H,2-5H2,1H3,(H3,14,15,16,19)/t6?,7-,11+/m1/s1 |
| InChIKey | FIUZQTOHLAAGLX-ZDLXNRETSA-N |
| XLogP | 0.87 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |