C12H15N7O4S — CID 137108756
5-amino-3-[(2R,3R,5S)-3-azido-5-(1-hydroxypropyl)oxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione (PubChem CID 137108756) has the molecular formula C12H15N7O4S and a molecular weight of 353.36 g/mol. Its IUPAC name is 5-amino-3-[(2R,3R,5S)-3-azido-5-(1-hydroxypropyl)oxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione.
| Compound Name | 5-amino-3-[(2R,3R,5S)-3-azido-5-(1-hydroxypropyl)oxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 137108756 |
| Molecular Formula | C12H15N7O4S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 5-amino-3-[(2R,3R,5S)-3-azido-5-(1-hydroxypropyl)oxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
| SMILES | CCC(O)[C@@H]1C[C@@H](N=[N+]=[N-])[C@H](n2c(=O)sc3c(=O)[nH]c(N)nc32)O1 |
| InChI | InChI=1S/C12H15N7O4S/c1-2-5(20)6-3-4(17-18-14)10(23-6)19-8-7(24-12(19)22)9(21)16-11(13)15-8/h4-6,10,20H,2-3H2,1H3,(H3,13,15,16,21)/t4-,5?,6+,10-/m1/s1 |
| InChIKey | RLLOHXQIPZNMEJ-GHPRUCIASA-N |
| XLogP | 0.47 |
| TPSA | 171.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|