C15H20N4O5S2 — CID 137108758
1-[(2S,4R,5R)-5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-4-methylsulfanyloxolan-2-yl]propyl acetate (PubChem CID 137108758) has the molecular formula C15H20N4O5S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-[(2S,4R,5R)-5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-4-methylsulfanyloxolan-2-yl]propyl acetate.
| Compound Name | 1-[(2S,4R,5R)-5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-4-methylsulfanyloxolan-2-yl]propyl acetate |
|---|---|
| PubChem CID | 137108758 |
| Molecular Formula | C15H20N4O5S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1-[(2S,4R,5R)-5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-4-methylsulfanyloxolan-2-yl]propyl acetate |
| SMILES | CCC(OC(C)=O)[C@@H]1C[C@@H](SC)[C@H](n2c(=O)sc3c(=O)[nH]c(N)nc32)O1 |
| InChI | InChI=1S/C15H20N4O5S2/c1-4-7(23-6(2)20)8-5-9(25-3)13(24-8)19-11-10(26-15(19)22)12(21)18-14(16)17-11/h7-9,13H,4-5H2,1-3H3,(H3,16,17,18,21)/t7?,8-,9+,13+/m0/s1 |
| InChIKey | GXWAULKDYUDSPC-SNRZFYHUSA-N |
| XLogP | 1.09 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |