C20H23N3OS — CID 137086171
(5Z)-2-(2,4-dimethylphenyl)imino-5-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137086171) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is (5Z)-2-(2,4-dimethylphenyl)imino-5-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2,4-dimethylphenyl)imino-5-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137086171 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (5Z)-2-(2,4-dimethylphenyl)imino-5-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCn1c(C)cc(/C=C2\S/C(=N/c3ccc(C)cc3C)NC2=O)c1C |
| InChI | InChI=1S/C20H23N3OS/c1-6-23-14(4)10-16(15(23)5)11-18-19(24)22-20(25-18)21-17-8-7-12(2)9-13(17)3/h7-11H,6H2,1-5H3,(H,21,22,24)/b18-11- |
| InChIKey | BKYWUGMTFDFYRN-WQRHYEAKSA-N |
| XLogP | 4.63 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|