C24H22BrN3OS — CID 137020335
(5Z)-2-(4-bromo-2-methylphenyl)imino-5-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137020335) has the molecular formula C24H22BrN3OS and a molecular weight of 480.43 g/mol. Its IUPAC name is (5Z)-2-(4-bromo-2-methylphenyl)imino-5-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-bromo-2-methylphenyl)imino-5-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137020335 |
| Molecular Formula | C24H22BrN3OS |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | (5Z)-2-(4-bromo-2-methylphenyl)imino-5-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(-n2c(C)cc(/C=C3\S/C(=N\c4ccc(Br)cc4C)NC3=O)c2C)c1 |
| InChI | InChI=1S/C24H22BrN3OS/c1-14-6-5-7-20(10-14)28-16(3)12-18(17(28)4)13-22-23(29)27-24(30-22)26-21-9-8-19(25)11-15(21)2/h5-13H,1-4H3,(H,26,27,29)/b22-13- |
| InChIKey | WMGLRIDQTBKGHG-XKZIYDEJSA-N |
| XLogP | 6.37 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|