C25H20N6 — CID 137087096
N-[(1E,3Z)-2-[3-(4-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)-1H-indazol-5-yl]penta-1,3-dienyl]methanimine (PubChem CID 137087096) has the molecular formula C25H20N6 and a molecular weight of 404.48 g/mol. Its IUPAC name is N-[(1E,3Z)-2-[3-(4-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)-1H-indazol-5-yl]penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3Z)-2-[3-(4-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)-1H-indazol-5-yl]penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 137087096 |
| Molecular Formula | C25H20N6 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[(1E,3Z)-2-[3-(4-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)-1H-indazol-5-yl]penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C/C)c1ccc2[nH]nc(-c3cc4c(-c5cccnc5)ccnc4[nH]3)c2c1 |
| InChI | InChI=1S/C25H20N6/c1-3-5-17(14-26-2)16-7-8-22-21(12-16)24(31-30-22)23-13-20-19(9-11-28-25(20)29-23)18-6-4-10-27-15-18/h3-15H,2H2,1H3,(H,28,29)(H,30,31)/b5-3-,17-14+ |
| InChIKey | QWPIYDBBBVDEOT-BJVVUDQBSA-N |
| XLogP | 5.79 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|