C26H20FN5 — CID 145245669
N-[(1E,3Z)-2-[3-[4-(3-fluorophenyl)-1H-indol-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]penta-1,3-dienyl]methanimine (PubChem CID 145245669) has the molecular formula C26H20FN5 and a molecular weight of 421.48 g/mol. Its IUPAC name is N-[(1E,3Z)-2-[3-[4-(3-fluorophenyl)-1H-indol-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3Z)-2-[3-[4-(3-fluorophenyl)-1H-indol-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 145245669 |
| Molecular Formula | C26H20FN5 |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-[(1E,3Z)-2-[3-[4-(3-fluorophenyl)-1H-indol-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C/C)c1cnc2n[nH]c(-c3cc4c(-c5cccc(F)c5)cccc4[nH]3)c2c1 |
| InChI | InChI=1S/C26H20FN5/c1-3-6-17(14-28-2)18-12-22-25(31-32-26(22)29-15-18)24-13-21-20(9-5-10-23(21)30-24)16-7-4-8-19(27)11-16/h3-15,30H,2H2,1H3,(H,29,31,32)/b6-3-,17-14+ |
| InChIKey | NKACNANOZGTTII-BTVHTEQHSA-N |
| XLogP | 6.53 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|