C25H20Cl2N2O2S — CID 137089500
(5E)-5-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137089500) has the molecular formula C25H20Cl2N2O2S and a molecular weight of 483.42 g/mol. Its IUPAC name is (5E)-5-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137089500 |
| Molecular Formula | C25H20Cl2N2O2S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | (5E)-5-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2/NC(=O)/C(=C\c3cccc(OCc4ccc(Cl)cc4Cl)c3)S2)c(C)c1 |
| InChI | InChI=1S/C25H20Cl2N2O2S/c1-15-6-9-22(16(2)10-15)28-25-29-24(30)23(32-25)12-17-4-3-5-20(11-17)31-14-18-7-8-19(26)13-21(18)27/h3-13H,14H2,1-2H3,(H,28,29,30)/b23-12+ |
| InChIKey | NDTDUDLVLOSTEA-FSJBWODESA-N |
| XLogP | 7.08 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|