C23H33N5O — CID 137090572
7-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methyl]-2-[(3R)-3-methylpiperidin-1-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 137090572) has the molecular formula C23H33N5O and a molecular weight of 395.55 g/mol. Its IUPAC name is 7-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methyl]-2-[(3R)-3-methylpiperidin-1-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methyl]-2-[(3R)-3-methylpiperidin-1-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137090572 |
| Molecular Formula | C23H33N5O |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 7-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methyl]-2-[(3R)-3-methylpiperidin-1-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | Cc1cc(CN2CCc3c(nc(N4CCC[C@@H](C)C4)[nH]c3=O)C2)c(C)n1C1CC1 |
| InChI | InChI=1S/C23H33N5O/c1-15-5-4-9-27(12-15)23-24-21-14-26(10-8-20(21)22(29)25-23)13-18-11-16(2)28(17(18)3)19-6-7-19/h11,15,19H,4-10,12-14H2,1-3H3,(H,24,25,29)/t15-/m1/s1 |
| InChIKey | RNWIBJDZHZCFTL-OAHLLOKOSA-N |
| XLogP | 3.32 |
| TPSA | 57.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |