C20H24F2N4O2 — CID 136888369
7-[(2,5-difluorophenyl)methyl]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 136888369) has the molecular formula C20H24F2N4O2 and a molecular weight of 390.43 g/mol. Its IUPAC name is 7-[(2,5-difluorophenyl)methyl]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2,5-difluorophenyl)methyl]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136888369 |
| Molecular Formula | C20H24F2N4O2 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 7-[(2,5-difluorophenyl)methyl]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | C[C@@H]1CN(c2nc3c(c(=O)[nH]2)CCN(Cc2cc(F)ccc2F)C3)C[C@H](C)O1 |
| InChI | InChI=1S/C20H24F2N4O2/c1-12-8-26(9-13(2)28-12)20-23-18-11-25(6-5-16(18)19(27)24-20)10-14-7-15(21)3-4-17(14)22/h3-4,7,12-13H,5-6,8-11H2,1-2H3,(H,23,24,27)/t12-,13+ |
| InChIKey | OPINKMDPHFRZHM-BETUJISGSA-N |
| XLogP | 2.22 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |