C22H29N5O3 — CID 136888342
N-[4-[[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-7-yl]methyl]phenyl]acetamide (PubChem CID 136888342) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[4-[[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-7-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-7-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 136888342 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | N-[4-[[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-7-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN2CCc3c(nc(N4C[C@@H](C)O[C@H](C)C4)[nH]c3=O)C2)cc1 |
| InChI | InChI=1S/C22H29N5O3/c1-14-10-27(11-15(2)30-14)22-24-20-13-26(9-8-19(20)21(29)25-22)12-17-4-6-18(7-5-17)23-16(3)28/h4-7,14-15H,8-13H2,1-3H3,(H,23,28)(H,24,25,29)/t14-,15-/m1/s1 |
| InChIKey | FNYKUOLKYZUBGW-HUUCEWRRSA-N |
| XLogP | 1.90 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |