C23H27N5O2 — CID 136888293
2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-7-(quinolin-8-ylmethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 136888293) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-7-(quinolin-8-ylmethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-7-(quinolin-8-ylmethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136888293 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-7-(quinolin-8-ylmethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | C[C@H]1CN(c2nc3c(c(=O)[nH]2)CCN(Cc2cccc4cccnc24)C3)C[C@H](C)O1 |
| InChI | InChI=1S/C23H27N5O2/c1-15-11-28(12-16(2)30-15)23-25-20-14-27(10-8-19(20)22(29)26-23)13-18-6-3-5-17-7-4-9-24-21(17)18/h3-7,9,15-16H,8,10-14H2,1-2H3,(H,25,26,29)/t15-,16-/m0/s1 |
| InChIKey | PGJUTWVFDYSYAC-HOTGVXAUSA-N |
| XLogP | 2.49 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |