C18H23BrN4O2S — CID 136798287
7-[(5-bromothiophen-2-yl)methyl]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 136798287) has the molecular formula C18H23BrN4O2S and a molecular weight of 439.38 g/mol. Its IUPAC name is 7-[(5-bromothiophen-2-yl)methyl]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(5-bromothiophen-2-yl)methyl]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136798287 |
| Molecular Formula | C18H23BrN4O2S |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 7-[(5-bromothiophen-2-yl)methyl]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | C[C@H]1CN(c2nc3c(c(=O)[nH]2)CCN(Cc2ccc(Br)s2)C3)C[C@H](C)O1 |
| InChI | InChI=1S/C18H23BrN4O2S/c1-11-7-23(8-12(2)25-11)18-20-15-10-22(6-5-14(15)17(24)21-18)9-13-3-4-16(19)26-13/h3-4,11-12H,5-10H2,1-2H3,(H,20,21,24)/t11-,12-/m0/s1 |
| InChIKey | XQKFSOZTSPNTSK-RYUDHWBXSA-N |
| XLogP | 2.77 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |