C20H25ClN4O2 — CID 136888329
7-[(3-chlorophenyl)methyl]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 136888329) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is 7-[(3-chlorophenyl)methyl]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(3-chlorophenyl)methyl]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136888329 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 7-[(3-chlorophenyl)methyl]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | C[C@H]1CN(c2nc3c(c(=O)[nH]2)CCN(Cc2cccc(Cl)c2)C3)C[C@H](C)O1 |
| InChI | InChI=1S/C20H25ClN4O2/c1-13-9-25(10-14(2)27-13)20-22-18-12-24(7-6-17(18)19(26)23-20)11-15-4-3-5-16(21)8-15/h3-5,8,13-14H,6-7,9-12H2,1-2H3,(H,22,23,26)/t13-,14-/m0/s1 |
| InChIKey | DWVQWFJBHWPEOR-KBPBESRZSA-N |
| XLogP | 2.60 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |