C23H22BrClN4O4S — CID 137093679
[2-(4-bromo-2-chloroanilino)-2-oxoethyl] N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 137093679) has the molecular formula C23H22BrClN4O4S and a molecular weight of 565.88 g/mol. Its IUPAC name is [2-(4-bromo-2-chloroanilino)-2-oxoethyl] N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | [2-(4-bromo-2-chloroanilino)-2-oxoethyl] N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 137093679 |
| Molecular Formula | C23H22BrClN4O4S |
| Molecular Weight | 565.88 g/mol |
| Exact Mass | 564.02 |
| IUPAC Name | [2-(4-bromo-2-chloroanilino)-2-oxoethyl] N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | Cc1ccc(/N=C(\SCC(=O)Nc2ccc(Br)cc2Cl)c2c(O)n(C)c(=O)n(C)c2=O)cc1C |
| InChI | InChI=1S/C23H22BrClN4O4S/c1-12-5-7-15(9-13(12)2)26-20(19-21(31)28(3)23(33)29(4)22(19)32)34-11-18(30)27-17-8-6-14(24)10-16(17)25/h5-10,31H,11H2,1-4H3,(H,27,30)/b26-20- |
| InChIKey | HOIYUGFYKSGZGO-QOMWVZHYSA-N |
| XLogP | 4.27 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.88 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|