C25H28N4O4S — CID 3958147
[2-(3,4-dimethylanilino)-2-oxoethyl] N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 3958147) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is [2-(3,4-dimethylanilino)-2-oxoethyl] N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | [2-(3,4-dimethylanilino)-2-oxoethyl] N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 3958147 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | [2-(3,4-dimethylanilino)-2-oxoethyl] N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | Cc1ccc(/N=C(\SCC(=O)Nc2ccc(C)c(C)c2)c2c(O)n(C)c(=O)n(C)c2=O)cc1C |
| InChI | InChI=1S/C25H28N4O4S/c1-14-7-9-18(11-16(14)3)26-20(30)13-34-22(27-19-10-8-15(2)17(4)12-19)21-23(31)28(5)25(33)29(6)24(21)32/h7-12,31H,13H2,1-6H3,(H,26,30)/b27-22- |
| InChIKey | JHMWBCPOJAJOJP-QYQHSDTDSA-N |
| XLogP | 3.47 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|