C22H22N4O4S — CID 137094231
(2-anilino-2-oxoethyl) 4-hydroxy-1,3-dimethyl-N-(4-methylphenyl)-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 137094231) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 4-hydroxy-1,3-dimethyl-N-(4-methylphenyl)-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | (2-anilino-2-oxoethyl) 4-hydroxy-1,3-dimethyl-N-(4-methylphenyl)-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 137094231 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (2-anilino-2-oxoethyl) 4-hydroxy-1,3-dimethyl-N-(4-methylphenyl)-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | Cc1ccc(/N=C(\SCC(=O)Nc2ccccc2)c2c(O)n(C)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C22H22N4O4S/c1-14-9-11-16(12-10-14)24-19(18-20(28)25(2)22(30)26(3)21(18)29)31-13-17(27)23-15-7-5-4-6-8-15/h4-12,28H,13H2,1-3H3,(H,23,27)/b24-19- |
| InChIKey | NUGROYLVUHRWTK-CLCOLTQESA-N |
| XLogP | 2.55 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|