C23H22Cl2N4O4S — CID 137093692
[2-(3,4-dichloroanilino)-2-oxoethyl] N-(4-ethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 137093692) has the molecular formula C23H22Cl2N4O4S and a molecular weight of 521.43 g/mol. Its IUPAC name is [2-(3,4-dichloroanilino)-2-oxoethyl] N-(4-ethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | [2-(3,4-dichloroanilino)-2-oxoethyl] N-(4-ethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 137093692 |
| Molecular Formula | C23H22Cl2N4O4S |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | [2-(3,4-dichloroanilino)-2-oxoethyl] N-(4-ethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | CCc1ccc(/N=C(\SCC(=O)Nc2ccc(Cl)c(Cl)c2)c2c(O)n(C)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C23H22Cl2N4O4S/c1-4-13-5-7-14(8-6-13)27-20(19-21(31)28(2)23(33)29(3)22(19)32)34-12-18(30)26-15-9-10-16(24)17(25)11-15/h5-11,31H,4,12H2,1-3H3,(H,26,30)/b27-20- |
| InChIKey | MSJHPRBBZGQJKW-OOAXWGSJSA-N |
| XLogP | 4.11 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|