C23H23FN4O4S — CID 3950252
[2-(2-fluoroanilino)-2-oxoethyl] N-(4-ethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 3950252) has the molecular formula C23H23FN4O4S and a molecular weight of 470.53 g/mol. Its IUPAC name is [2-(2-fluoroanilino)-2-oxoethyl] N-(4-ethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | [2-(2-fluoroanilino)-2-oxoethyl] N-(4-ethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 3950252 |
| Molecular Formula | C23H23FN4O4S |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | [2-(2-fluoroanilino)-2-oxoethyl] N-(4-ethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | CCc1ccc(/N=C(\SCC(=O)Nc2ccccc2F)c2c(O)n(C)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C23H23FN4O4S/c1-4-14-9-11-15(12-10-14)25-20(19-21(30)27(2)23(32)28(3)22(19)31)33-13-18(29)26-17-8-6-5-7-16(17)24/h5-12,30H,4,13H2,1-3H3,(H,26,29)/b25-20- |
| InChIKey | YABAMWUEFMCXBH-QQTULTPQSA-N |
| XLogP | 2.94 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|