C22H22N4O5S — CID 3905884
[2-(2-methoxyanilino)-2-oxoethyl] 4-hydroxy-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboximidothioate (PubChem CID 3905884) has the molecular formula C22H22N4O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl] 4-hydroxy-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboximidothioate.
| Compound Name | [2-(2-methoxyanilino)-2-oxoethyl] 4-hydroxy-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 3905884 |
| Molecular Formula | C22H22N4O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl] 4-hydroxy-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboximidothioate |
| SMILES | COc1ccccc1NC(=O)CS/C(=N\c1ccccc1)c1c(O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C22H22N4O5S/c1-25-20(28)18(21(29)26(2)22(25)30)19(23-14-9-5-4-6-10-14)32-13-17(27)24-15-11-7-8-12-16(15)31-3/h4-12,28H,13H2,1-3H3,(H,24,27)/b23-19- |
| InChIKey | HOCUUOACTUSPCR-NMWGTECJSA-N |
| XLogP | 2.25 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|