C24H20FN3O3S — CID 137093976
naphthalen-1-ylmethyl N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 137093976) has the molecular formula C24H20FN3O3S and a molecular weight of 449.51 g/mol. Its IUPAC name is naphthalen-1-ylmethyl N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | naphthalen-1-ylmethyl N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 137093976 |
| Molecular Formula | C24H20FN3O3S |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | naphthalen-1-ylmethyl N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | Cn1c(O)c(/C(=N/c2ccc(F)cc2)SCc2cccc3ccccc23)c(=O)n(C)c1=O |
| InChI | InChI=1S/C24H20FN3O3S/c1-27-22(29)20(23(30)28(2)24(27)31)21(26-18-12-10-17(25)11-13-18)32-14-16-8-5-7-15-6-3-4-9-19(15)16/h3-13,29H,14H2,1-2H3/b26-21- |
| InChIKey | RZOXDDHBDCPJAH-QLYXXIJNSA-N |
| XLogP | 4.09 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|