C26H25N3O3S — CID 3284841
naphthalen-2-ylmethyl N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 3284841) has the molecular formula C26H25N3O3S and a molecular weight of 459.57 g/mol. Its IUPAC name is naphthalen-2-ylmethyl N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | naphthalen-2-ylmethyl N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 3284841 |
| Molecular Formula | C26H25N3O3S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | naphthalen-2-ylmethyl N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | Cc1ccc(/N=C(\SCc2ccc3ccccc3c2)c2c(O)n(C)c(=O)n(C)c2=O)cc1C |
| InChI | InChI=1S/C26H25N3O3S/c1-16-9-12-21(13-17(16)2)27-23(22-24(30)28(3)26(32)29(4)25(22)31)33-15-18-10-11-19-7-5-6-8-20(19)14-18/h5-14,30H,15H2,1-4H3/b27-23- |
| InChIKey | HFLRWLDNUSCUBH-VYIQYICTSA-N |
| XLogP | 4.57 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|