C32H33N5O3S2 — CID 169306264
3-benzyl-5-[(E)-[2-[(5-butyl-5,6,7,8-tetrahydronaphthalen-2-yl)diazenyl]-2H-thieno[2,3-d][1,3]thiazol-5-ylidene]methyl]-6-hydroxy-1-methylpyrimidine-2,4-dione (PubChem CID 169306264) has the molecular formula C32H33N5O3S2 and a molecular weight of 599.78 g/mol. Its IUPAC name is 3-benzyl-5-[(E)-[2-[(5-butyl-5,6,7,8-tetrahydronaphthalen-2-yl)diazenyl]-2H-thieno[2,3-d][1,3]thiazol-5-ylidene]methyl]-6-hydroxy-1-methylpyrimidine-2,4-dione.
| Compound Name | 3-benzyl-5-[(E)-[2-[(5-butyl-5,6,7,8-tetrahydronaphthalen-2-yl)diazenyl]-2H-thieno[2,3-d][1,3]thiazol-5-ylidene]methyl]-6-hydroxy-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169306264 |
| Molecular Formula | C32H33N5O3S2 |
| Molecular Weight | 599.78 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | 3-benzyl-5-[(E)-[2-[(5-butyl-5,6,7,8-tetrahydronaphthalen-2-yl)diazenyl]-2H-thieno[2,3-d][1,3]thiazol-5-ylidene]methyl]-6-hydroxy-1-methylpyrimidine-2,4-dione |
| SMILES | CCCCC1CCCc2cc(/N=N/C3N=c4s/c(=C/c5c(O)n(C)c(=O)n(Cc6ccccc6)c5=O)cc4S3)ccc21 |
| InChI | InChI=1S/C32H33N5O3S2/c1-3-4-11-21-12-8-13-22-16-23(14-15-25(21)22)34-35-31-33-28-27(42-31)18-24(41-28)17-26-29(38)36(2)32(40)37(30(26)39)19-20-9-6-5-7-10-20/h5-7,9-10,14-18,21,31,38H,3-4,8,11-13,19H2,1-2H3/b24-17+,35-34+ |
| InChIKey | VBCXBABNTUMZML-IDIKORIISA-N |
| XLogP | 5.59 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.78 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|