C8H16N4O2S — CID 137095882
N-[1-[(Z)-3-aminoprop-2-enimidoyl]pyrrolidin-3-yl]methanesulfonamide (PubChem CID 137095882) has the molecular formula C8H16N4O2S and a molecular weight of 232.31 g/mol. Its IUPAC name is N-[1-[(Z)-3-aminoprop-2-enimidoyl]pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | N-[1-[(Z)-3-aminoprop-2-enimidoyl]pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 137095882 |
| Molecular Formula | C8H16N4O2S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-[1-[(Z)-3-aminoprop-2-enimidoyl]pyrrolidin-3-yl]methanesulfonamide |
| SMILES | [H]/N=C(\C=C/N)N1CCC(NS(C)(=O)=O)C1 |
| InChI | InChI=1S/C8H16N4O2S/c1-15(13,14)11-7-3-5-12(6-7)8(10)2-4-9/h2,4,7,10-11H,3,5-6,9H2,1H3/b4-2-,10-8+ |
| InChIKey | DFDSCWMTCRETEW-SFJBRHGZSA-N |
| XLogP | -0.94 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|