About 3-fluoro-2,6-dimethyl-5H-pyrazolo[4,3-c]pyridin-4-one
3-fluoro-2,6-dimethyl-5H-pyrazolo[4,3-c]pyridin-4-one (PubChem CID 137095947) has the molecular formula C8H8FN3O
and a molecular weight of 181.17 g/mol. Its IUPAC name is 3-fluoro-2,6-dimethyl-5H-pyrazolo[4,3-c]pyridin-4-one.
Analyze 3-fluoro-2,6-dimethyl-5H-pyrazolo[4,3-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2,6-dimethyl-5H-pyrazolo[4,3-c]pyridin-4-one?
The IUPAC name of 3-fluoro-2,6-dimethyl-5H-pyrazolo[4,3-c]pyridin-4-one (CID 137095947) is 3-fluoro-2,6-dimethyl-5H-pyrazolo[4,3-c]pyridin-4-one.
What is the SMILES notation for 3-fluoro-2,6-dimethyl-5H-pyrazolo[4,3-c]pyridin-4-one?
The canonical SMILES for 3-fluoro-2,6-dimethyl-5H-pyrazolo[4,3-c]pyridin-4-one is Cc1cc2nn(C)c(F)c2c(=O)[nH]1.
What is the InChIKey of 3-fluoro-2,6-dimethyl-5H-pyrazolo[4,3-c]pyridin-4-one?
The InChIKey is BVNPSGMKVCRYLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN3O/c1-4-3-5-6(8(13)10-4)7(9)12(2)11-5/h3H,1-2H3,(H,10,13).
What are the key properties of 3-fluoro-2,6-dimethyl-5H-pyrazolo[4,3-c]pyridin-4-one?
3-fluoro-2,6-dimethyl-5H-pyrazolo[4,3-c]pyridin-4-one has a molecular weight of 181.17 g/mol, XLogP of 0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2,6-dimethyl-5H-pyrazolo[4,3-c]pyridin-4-one is sourced from PubChem (CID 137095947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).