C28H27N3O — CID 137097188
2-hydroxy-N-[methylamino(phenyl)methyl]-N'-[(4-phenylphenyl)methyl]benzenecarboximidamide (PubChem CID 137097188) has the molecular formula C28H27N3O and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-hydroxy-N-[methylamino(phenyl)methyl]-N'-[(4-phenylphenyl)methyl]benzenecarboximidamide.
| Compound Name | 2-hydroxy-N-[methylamino(phenyl)methyl]-N'-[(4-phenylphenyl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 137097188 |
| Molecular Formula | C28H27N3O |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 2-hydroxy-N-[methylamino(phenyl)methyl]-N'-[(4-phenylphenyl)methyl]benzenecarboximidamide |
| SMILES | CNC(N/C(=N/Cc1ccc(-c2ccccc2)cc1)c1ccccc1O)c1ccccc1 |
| InChI | InChI=1S/C28H27N3O/c1-29-27(24-12-6-3-7-13-24)31-28(25-14-8-9-15-26(25)32)30-20-21-16-18-23(19-17-21)22-10-4-2-5-11-22/h2-19,27,29,32H,20H2,1H3,(H,30,31) |
| InChIKey | CIRREPRXPJGIKS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|