C6H11Cl2N3O — CID 137098529
2-(aminomethyl)-4-methyl-1H-pyrimidin-6-one;dihydrochloride (PubChem CID 137098529) has the molecular formula C6H11Cl2N3O and a molecular weight of 212.08 g/mol. Its IUPAC name is 2-(aminomethyl)-4-methyl-1H-pyrimidin-6-one;dihydrochloride.
| Compound Name | 2-(aminomethyl)-4-methyl-1H-pyrimidin-6-one;dihydrochloride |
|---|---|
| PubChem CID | 137098529 |
| Molecular Formula | C6H11Cl2N3O |
| Molecular Weight | 212.08 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 2-(aminomethyl)-4-methyl-1H-pyrimidin-6-one;dihydrochloride |
| SMILES | Cc1cc(=O)[nH]c(CN)n1.Cl.Cl |
| InChI | InChI=1S/C6H9N3O.2ClH/c1-4-2-6(10)9-5(3-7)8-4;;/h2H,3,7H2,1H3,(H,8,9,10);2*1H |
| InChIKey | XXPOYZKOKVLJAV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.08 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |