C9H16N5O4P — CID 137099740
1-(6-amino-2,3-dihydropurin-9-yl)propan-2-yloxymethylphosphonic acid (PubChem CID 137099740) has the molecular formula C9H16N5O4P and a molecular weight of 289.23 g/mol. Its IUPAC name is 1-(6-amino-2,3-dihydropurin-9-yl)propan-2-yloxymethylphosphonic acid.
| Compound Name | 1-(6-amino-2,3-dihydropurin-9-yl)propan-2-yloxymethylphosphonic acid |
|---|---|
| PubChem CID | 137099740 |
| Molecular Formula | C9H16N5O4P |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-(6-amino-2,3-dihydropurin-9-yl)propan-2-yloxymethylphosphonic acid |
| SMILES | CC(Cn1cnc2c1NCN=C2N)OCP(=O)(O)O |
| InChI | InChI=1S/C9H16N5O4P/c1-6(18-5-19(15,16)17)2-14-4-13-7-8(10)11-3-12-9(7)14/h4,6,12H,2-3,5H2,1H3,(H2,10,11)(H2,15,16,17) |
| InChIKey | PTJYTMIDEAMWOB-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|