C25H24ClN5O3S — CID 137100838
1-[(E)-[4-[(4-chlorophenyl)methoxy]-2-hydroxyphenyl]methylideneamino]-3-[6-[(dimethylamino)methyl]-1,3-benzothiazol-2-yl]urea (PubChem CID 137100838) has the molecular formula C25H24ClN5O3S and a molecular weight of 510.02 g/mol. Its IUPAC name is 1-[(E)-[4-[(4-chlorophenyl)methoxy]-2-hydroxyphenyl]methylideneamino]-3-[6-[(dimethylamino)methyl]-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-[(E)-[4-[(4-chlorophenyl)methoxy]-2-hydroxyphenyl]methylideneamino]-3-[6-[(dimethylamino)methyl]-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 137100838 |
| Molecular Formula | C25H24ClN5O3S |
| Molecular Weight | 510.02 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 1-[(E)-[4-[(4-chlorophenyl)methoxy]-2-hydroxyphenyl]methylideneamino]-3-[6-[(dimethylamino)methyl]-1,3-benzothiazol-2-yl]urea |
| SMILES | CN(C)Cc1ccc2nc(NC(=O)N/N=C/c3ccc(OCc4ccc(Cl)cc4)cc3O)sc2c1 |
| InChI | InChI=1S/C25H24ClN5O3S/c1-31(2)14-17-5-10-21-23(11-17)35-25(28-21)29-24(33)30-27-13-18-6-9-20(12-22(18)32)34-15-16-3-7-19(26)8-4-16/h3-13,32H,14-15H2,1-2H3,(H2,28,29,30,33)/b27-13+ |
| InChIKey | OWXTZNAERPNOTL-UVHMKAGCSA-N |
| XLogP | 5.45 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.02 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|