About 4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol
4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol (PubChem CID 137100959) has the molecular formula C10H15N2OPS
and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol.
Molecular Properties
| Compound Name | 4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol |
| PubChem CID | 137100959 |
| Molecular Formula | C10H15N2OPS |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol |
| SMILES | CN(/N=C/c1ccc(O)cc1)P=S(C)C |
| InChI | InChI=1S/C10H15N2OPS/c1-12(14-15(2)3)11-8-9-4-6-10(13)7-5-9/h4-8,13H,1-3H3/b11-8+ |
| InChIKey | WKNBNNZIGRGAPB-DHZHZOJOSA-N |
| XLogP | 2.31 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol?
The IUPAC name of 4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol (CID 137100959) is 4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol.
What is the SMILES notation for 4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol?
The canonical SMILES for 4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol is CN(/N=C/c1ccc(O)cc1)P=S(C)C.
What is the InChIKey of 4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol?
The InChIKey is WKNBNNZIGRGAPB-DHZHZOJOSA-N. The full InChI is InChI=1S/C10H15N2OPS/c1-12(14-15(2)3)11-8-9-4-6-10(13)7-5-9/h4-8,13H,1-3H3/b11-8+.
What are the key properties of 4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol?
4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol has a molecular weight of 242.28 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-[(dimethyl-λ4-sulfanylidene)phosphanyl-methylhydrazinylidene]methyl]phenol is sourced from PubChem (CID 137100959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).