C28H28F6N4O — CID 137102001
2-(benzotriazol-2-yl)-6-[3,5-bis(trifluoromethyl)anilino]-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 137102001) has the molecular formula C28H28F6N4O and a molecular weight of 550.55 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-6-[3,5-bis(trifluoromethyl)anilino]-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-(benzotriazol-2-yl)-6-[3,5-bis(trifluoromethyl)anilino]-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 137102001 |
| Molecular Formula | C28H28F6N4O |
| Molecular Weight | 550.55 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 2-(benzotriazol-2-yl)-6-[3,5-bis(trifluoromethyl)anilino]-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1cc(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C28H28F6N4O/c1-25(2,3)15-26(4,5)16-13-22(24(39)23(14-16)38-36-20-8-6-7-9-21(20)37-38)35-19-11-17(27(29,30)31)10-18(12-19)28(32,33)34/h6-14,35,39H,15H2,1-5H3 |
| InChIKey | QBSYDNOSAWXKRC-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.55 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|