C24H22N2O — CID 137107411
N-(2,4-dimethylphenyl)-1-(5-methoxy-2-phenyl-1H-indol-3-yl)methanimine (PubChem CID 137107411) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-(5-methoxy-2-phenyl-1H-indol-3-yl)methanimine.
| Compound Name | N-(2,4-dimethylphenyl)-1-(5-methoxy-2-phenyl-1H-indol-3-yl)methanimine |
|---|---|
| PubChem CID | 137107411 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-(5-methoxy-2-phenyl-1H-indol-3-yl)methanimine |
| SMILES | COc1ccc2[nH]c(-c3ccccc3)c(/C=N/c3ccc(C)cc3C)c2c1 |
| InChI | InChI=1S/C24H22N2O/c1-16-9-11-22(17(2)13-16)25-15-21-20-14-19(27-3)10-12-23(20)26-24(21)18-7-5-4-6-8-18/h4-15,26H,1-3H3/b25-15+ |
| InChIKey | KKFQBAQPCDYBMH-MFKUBSTISA-N |
| XLogP | 6.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|