C25H23N3O4 — CID 137166777
3,5-dimethoxy-N-[(Z)-(5-methoxy-2-phenyl-1H-indol-3-yl)methylideneamino]benzamide (PubChem CID 137166777) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[(Z)-(5-methoxy-2-phenyl-1H-indol-3-yl)methylideneamino]benzamide.
| Compound Name | 3,5-dimethoxy-N-[(Z)-(5-methoxy-2-phenyl-1H-indol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 137166777 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 3,5-dimethoxy-N-[(Z)-(5-methoxy-2-phenyl-1H-indol-3-yl)methylideneamino]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N/N=C\c2c(-c3ccccc3)[nH]c3ccc(OC)cc23)c1 |
| InChI | InChI=1S/C25H23N3O4/c1-30-18-9-10-23-21(14-18)22(24(27-23)16-7-5-4-6-8-16)15-26-28-25(29)17-11-19(31-2)13-20(12-17)32-3/h4-15,27H,1-3H3,(H,28,29)/b26-15- |
| InChIKey | KHCIDBYMQWNOEF-YSMPRRRNSA-N |
| XLogP | 4.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|