C24H24ClN3O4S — CID 137107847
2-(3-chloro-4-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]acetamide (PubChem CID 137107847) has the molecular formula C24H24ClN3O4S and a molecular weight of 485.99 g/mol. Its IUPAC name is 2-(3-chloro-4-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]acetamide.
| Compound Name | 2-(3-chloro-4-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 137107847 |
| Molecular Formula | C24H24ClN3O4S |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 2-(3-chloro-4-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CN(c1ccc(C)c(Cl)c1)S(=O)(=O)c1ccc(C)cc1)c1ccccc1O |
| InChI | InChI=1S/C24H24ClN3O4S/c1-16-8-12-20(13-9-16)33(31,32)28(19-11-10-17(2)22(25)14-19)15-24(30)27-26-18(3)21-6-4-5-7-23(21)29/h4-14,29H,15H2,1-3H3,(H,27,30)/b26-18- |
| InChIKey | AMJTZIKELDYPHN-ITYLOYPMSA-N |
| XLogP | 4.40 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|