C23H22ClN3O4S — CID 137044533
2-(3-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]acetamide (PubChem CID 137044533) has the molecular formula C23H22ClN3O4S and a molecular weight of 471.97 g/mol. Its IUPAC name is 2-(3-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]acetamide.
| Compound Name | 2-(3-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 137044533 |
| Molecular Formula | C23H22ClN3O4S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 2-(3-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CN(c1cccc(Cl)c1)S(=O)(=O)c1ccc(C)cc1)c1ccccc1O |
| InChI | InChI=1S/C23H22ClN3O4S/c1-16-10-12-20(13-11-16)32(30,31)27(19-7-5-6-18(24)14-19)15-23(29)26-25-17(2)21-8-3-4-9-22(21)28/h3-14,28H,15H2,1-2H3,(H,26,29)/b25-17- |
| InChIKey | ZKLKEXQYKMBDDX-UQQQWYQISA-N |
| XLogP | 4.09 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|