C23H30ClN3O3S — CID 3536506
2-[N-(benzenesulfonyl)-3-chloroanilino]-N-(nonan-2-ylideneamino)acetamide (PubChem CID 3536506) has the molecular formula C23H30ClN3O3S and a molecular weight of 464.03 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-(nonan-2-ylideneamino)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-(nonan-2-ylideneamino)acetamide |
|---|---|
| PubChem CID | 3536506 |
| Molecular Formula | C23H30ClN3O3S |
| Molecular Weight | 464.03 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-(nonan-2-ylideneamino)acetamide |
| SMILES | CCCCCCCC(C)=NNC(=O)CN(c1cccc(Cl)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H30ClN3O3S/c1-3-4-5-6-8-12-19(2)25-26-23(28)18-27(21-14-11-13-20(24)17-21)31(29,30)22-15-9-7-10-16-22/h7,9-11,13-17H,3-6,8,12,18H2,1-2H3,(H,26,28) |
| InChIKey | QWCRGNFYVUFDFO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.03 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|