C17H13N5O5 — CID 137108296
5-hydroxy-1-[(4-nitrophenyl)methyl]-6-oxo-2-pyridin-2-ylpyrimidine-4-carboxamide (PubChem CID 137108296) has the molecular formula C17H13N5O5 and a molecular weight of 367.32 g/mol. Its IUPAC name is 5-hydroxy-1-[(4-nitrophenyl)methyl]-6-oxo-2-pyridin-2-ylpyrimidine-4-carboxamide.
| Compound Name | 5-hydroxy-1-[(4-nitrophenyl)methyl]-6-oxo-2-pyridin-2-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 137108296 |
| Molecular Formula | C17H13N5O5 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 5-hydroxy-1-[(4-nitrophenyl)methyl]-6-oxo-2-pyridin-2-ylpyrimidine-4-carboxamide |
| SMILES | NC(=O)c1nc(-c2ccccn2)n(Cc2ccc([N+](=O)[O-])cc2)c(=O)c1O |
| InChI | InChI=1S/C17H13N5O5/c18-15(24)13-14(23)17(25)21(16(20-13)12-3-1-2-8-19-12)9-10-4-6-11(7-5-10)22(26)27/h1-8,23H,9H2,(H2,18,24) |
| InChIKey | HLNZRPLGDHHKBD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 154.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|