C13H16N5O6PS — CID 137108859
9-[(4aR,6R)-7-hydroxy-2-prop-2-enoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one (PubChem CID 137108859) has the molecular formula C13H16N5O6PS and a molecular weight of 401.34 g/mol. Its IUPAC name is 9-[(4aR,6R)-7-hydroxy-2-prop-2-enoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one.
| Compound Name | 9-[(4aR,6R)-7-hydroxy-2-prop-2-enoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one |
|---|---|
| PubChem CID | 137108859 |
| Molecular Formula | C13H16N5O6PS |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 9-[(4aR,6R)-7-hydroxy-2-prop-2-enoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one |
| SMILES | C=CCOP1(=S)OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(N)nc43)C(O)C2O1 |
| InChI | InChI=1S/C13H16N5O6PS/c1-2-3-21-25(26)22-4-6-9(24-25)8(19)12(23-6)18-5-15-7-10(18)16-13(14)17-11(7)20/h2,5-6,8-9,12,19H,1,3-4H2,(H3,14,16,17,20)/t6-,8?,9?,12-,25?/m1/s1 |
| InChIKey | OIYYNKDRCGTJJC-CYQRIJMASA-N |
| XLogP | -0.20 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|