C16H21N6O6PS — CID 159891590
N'-[9-[(4aR,6R)-7-hydroxy-2-prop-2-enoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 159891590) has the molecular formula C16H21N6O6PS and a molecular weight of 456.42 g/mol. Its IUPAC name is N'-[9-[(4aR,6R)-7-hydroxy-2-prop-2-enoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(4aR,6R)-7-hydroxy-2-prop-2-enoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 159891590 |
| Molecular Formula | C16H21N6O6PS |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | N'-[9-[(4aR,6R)-7-hydroxy-2-prop-2-enoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | C=CCOP1(=S)OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(N=CN(C)C)nc43)C(O)C2O1 |
| InChI | InChI=1S/C16H21N6O6PS/c1-4-5-25-29(30)26-6-9-12(28-29)11(23)15(27-9)22-8-17-10-13(22)19-16(20-14(10)24)18-7-21(2)3/h4,7-9,11-12,15,23H,1,5-6H2,2-3H3,(H,19,20,24)/t9-,11?,12?,15-,29?/m1/s1 |
| InChIKey | TZVJOPUDHIEOFJ-JJIVLTRJSA-N |
| XLogP | 0.44 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|