C20H20N4O — CID 137113298
4-(furan-3-yl)-2-(5-piperidin-4-yl-1H-pyrazol-3-yl)-1H-indole (PubChem CID 137113298) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is 4-(furan-3-yl)-2-(5-piperidin-4-yl-1H-pyrazol-3-yl)-1H-indole.
| Compound Name | 4-(furan-3-yl)-2-(5-piperidin-4-yl-1H-pyrazol-3-yl)-1H-indole |
|---|---|
| PubChem CID | 137113298 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 4-(furan-3-yl)-2-(5-piperidin-4-yl-1H-pyrazol-3-yl)-1H-indole |
| SMILES | c1cc(-c2ccoc2)c2cc(-c3cc(C4CCNCC4)[nH]n3)[nH]c2c1 |
| InChI | InChI=1S/C20H20N4O/c1-2-15(14-6-9-25-12-14)16-10-19(22-17(16)3-1)20-11-18(23-24-20)13-4-7-21-8-5-13/h1-3,6,9-13,21-22H,4-5,7-8H2,(H,23,24) |
| InChIKey | VXENXAKWGWUGOQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |