C29H25N5O2 — CID 137115273
3-[4-(furan-3-yl)-1H-indol-2-yl]-5-(5-piperidin-4-yloxy-3-pyridinyl)-1H-indazole (PubChem CID 137115273) has the molecular formula C29H25N5O2 and a molecular weight of 475.55 g/mol. Its IUPAC name is 3-[4-(furan-3-yl)-1H-indol-2-yl]-5-(5-piperidin-4-yloxy-3-pyridinyl)-1H-indazole.
| Compound Name | 3-[4-(furan-3-yl)-1H-indol-2-yl]-5-(5-piperidin-4-yloxy-3-pyridinyl)-1H-indazole |
|---|---|
| PubChem CID | 137115273 |
| Molecular Formula | C29H25N5O2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 3-[4-(furan-3-yl)-1H-indol-2-yl]-5-(5-piperidin-4-yloxy-3-pyridinyl)-1H-indazole |
| SMILES | c1cc(-c2ccoc2)c2cc(-c3n[nH]c4ccc(-c5cncc(OC6CCNCC6)c5)cc34)[nH]c2c1 |
| InChI | InChI=1S/C29H25N5O2/c1-2-23(19-8-11-35-17-19)24-14-28(32-26(24)3-1)29-25-13-18(4-5-27(25)33-34-29)20-12-22(16-31-15-20)36-21-6-9-30-10-7-21/h1-5,8,11-17,21,30,32H,6-7,9-10H2,(H,33,34) |
| InChIKey | CHPQOBSKNVLTGK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |