C31H28N4OS — CID 137115524
5-(5-cyclohexyloxy-3-pyridinyl)-3-[4-(5-methylthiophen-2-yl)-1H-indol-2-yl]-1H-indazole (PubChem CID 137115524) has the molecular formula C31H28N4OS and a molecular weight of 504.66 g/mol. Its IUPAC name is 5-(5-cyclohexyloxy-3-pyridinyl)-3-[4-(5-methylthiophen-2-yl)-1H-indol-2-yl]-1H-indazole.
| Compound Name | 5-(5-cyclohexyloxy-3-pyridinyl)-3-[4-(5-methylthiophen-2-yl)-1H-indol-2-yl]-1H-indazole |
|---|---|
| PubChem CID | 137115524 |
| Molecular Formula | C31H28N4OS |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 5-(5-cyclohexyloxy-3-pyridinyl)-3-[4-(5-methylthiophen-2-yl)-1H-indol-2-yl]-1H-indazole |
| SMILES | Cc1ccc(-c2cccc3[nH]c(-c4n[nH]c5ccc(-c6cncc(OC7CCCCC7)c6)cc45)cc23)s1 |
| InChI | InChI=1S/C31H28N4OS/c1-19-10-13-30(37-19)24-8-5-9-27-25(24)16-29(33-27)31-26-15-20(11-12-28(26)34-35-31)21-14-23(18-32-17-21)36-22-6-3-2-4-7-22/h5,8-18,22,33H,2-4,6-7H2,1H3,(H,34,35) |
| InChIKey | VDUIBAJEKFLBSD-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |